CAS 635-39-2 appears in our catalog under these names: Guanine Hydrochloride, Guanine hydrochloride monohydrate, Guanine Hydrochloride, >98.0%(T), Guanine hydrochloride, 98.00%, Guanine HCl 97%. Offered by: TRC, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 2,5g, 100g, 250g, 50g, 0,1kg, 0,25kg, 25g, 5g.
2-amino-1,7-dihydropurin-6-one;hydrochloride (CAS 635-39-2) is a chemical compound with the molecular formula C5H6ClN5O and a molecular weight of 187.59 g/mol. IUPAC name: 2-amino-1,7-dihydropurin-6-one;hydrochloride. InChIKey: IBAOFQIOOBQLHE-UHFFFAOYSA-N.
| Molecular formula | C5H6ClN5O |
|---|---|
| Molecular weight | 187.59 g/mol |
| IUPAC name | 2-amino-1,7-dihydropurin-6-one;hydrochloride |
| InChIKey | IBAOFQIOOBQLHE-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=O)NC(=N2)N.Cl |
Computed by PubChem (NCBI)