CAS 1153420-28-0 is the registry number for 2-Amino-6,6-dioxo-4H,5H,7H-6λâ¶-thieno(2,3-c)thiopyran-3-carbonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-6,6-dioxo-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carbonitrile (CAS 1153420-28-0) is a chemical compound with the molecular formula C8H8N2O2S2 and a molecular weight of 228.3 g/mol. IUPAC name: 2-amino-6,6-dioxo-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carbonitrile. InChIKey: HHWYJGKCKJFCTN-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2S2 |
|---|---|
| Molecular weight | 228.3 g/mol |
| IUPAC name | 2-amino-6,6-dioxo-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carbonitrile |
| InChIKey | HHWYJGKCKJFCTN-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC2=C1C(=C(S2)N)C#N |
Computed by PubChem (NCBI)