CAS 129332-45-2 appears in our catalog under these names: Methyl 3-amino-4-cyano-5-(methylthio)thiophene-2-carboxylate, 97%, Methyl 3-amino-4-cyano-5-(methylthio)thiophene-2-carboxylate. Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 10g, 5g, 25g.
Methyl 3-amino-4-cyano-5-methylsulfanylthiophene-2-carboxylate (CAS 129332-45-2) is a chemical compound with the molecular formula C8H8N2O2S2 and a molecular weight of 228.3 g/mol. IUPAC name: methyl 3-amino-4-cyano-5-methylsulfanylthiophene-2-carboxylate. InChIKey: VBXBCNWDAJLZOC-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2S2 |
|---|---|
| Molecular weight | 228.3 g/mol |
| IUPAC name | methyl 3-amino-4-cyano-5-methylsulfanylthiophene-2-carboxylate |
| InChIKey | VBXBCNWDAJLZOC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(S1)SC)C#N)N |
Computed by PubChem (NCBI)