CAS 19014-44-9 is the registry number for 2-(Methylsulfonyl)benzo[d]thiazol-6-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methylsulfonyl-1,3-benzothiazol-6-amine (CAS 19014-44-9) is a chemical compound with the molecular formula C8H8N2O2S2 and a molecular weight of 228.3 g/mol. IUPAC name: 2-methylsulfonyl-1,3-benzothiazol-6-amine. InChIKey: CGAVIHVJYPJDGP-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2S2 |
|---|---|
| Molecular weight | 228.3 g/mol |
| IUPAC name | 2-methylsulfonyl-1,3-benzothiazol-6-amine |
| InChIKey | CGAVIHVJYPJDGP-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NC2=C(S1)C=C(C=C2)N |
Computed by PubChem (NCBI)