CAS 51929-73-8 is the registry number for 4-(Isothiocyanatomethyl)benzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-(isothiocyanatomethyl)benzenesulfonamide (CAS 51929-73-8) is a chemical compound with the molecular formula C8H8N2O2S2 and a molecular weight of 228.3 g/mol. IUPAC name: 4-(isothiocyanatomethyl)benzenesulfonamide. InChIKey: ULZLNKDNBDCKLD-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2S2 |
|---|---|
| Molecular weight | 228.3 g/mol |
| IUPAC name | 4-(isothiocyanatomethyl)benzenesulfonamide |
| InChIKey | ULZLNKDNBDCKLD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN=C=S)S(=O)(=O)N |
Computed by PubChem (NCBI)