CAS 1153681-26-5 appears in our catalog under these names: (1R,3S)-3-(((Benzyloxy)carbonyl)amino)cyclohexyl acetate, 95%, (1R,3S)–3–(((Benzyloxy)Carbonyl)Amino)Cyclohexyl Acetate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
[(1R,3S)-3-(phenylmethoxycarbonylamino)cyclohexyl] acetate (CAS 1153681-26-5) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: [(1R,3S)-3-(phenylmethoxycarbonylamino)cyclohexyl] acetate. InChIKey: HONUIJYJMHZWAO-LSDHHAIUSA-N.
| Molecular formula | C16H21NO4 |
|---|---|
| Molecular weight | 291.34 g/mol |
| IUPAC name | [(1R,3S)-3-(phenylmethoxycarbonylamino)cyclohexyl] acetate |
| InChIKey | HONUIJYJMHZWAO-LSDHHAIUSA-N |
| SMILES | CC(=O)O[C@@H]1CCC[C@@H](C1)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)