Products 1153759-70-6

CAS 1153759-70-6 is the registry number for 6-[(2-Methoxyethyl)carbamoyl]pyridine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

6-(2-methoxyethylcarbamoyl)pyridine-2-carboxylic acid (CAS 1153759-70-6) is a chemical compound with the molecular formula C10H12N2O4 and a molecular weight of 224.21 g/mol. IUPAC name: 6-(2-methoxyethylcarbamoyl)pyridine-2-carboxylic acid. InChIKey: WNSIRVYZMCGWMR-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12N2O4
Molecular weight224.21 g/mol
IUPAC name6-(2-methoxyethylcarbamoyl)pyridine-2-carboxylic acid
InChIKeyWNSIRVYZMCGWMR-UHFFFAOYSA-N
SMILESCOCCNC(=O)C1=NC(=CC=C1)C(=O)O

Computed by PubChem (NCBI)