Products 1153823-55-2

CAS 1153823-55-2 is the registry number for 3-(4-Sulfamoyl-1H-pyrazol-1-yl)propanoic Acid. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 2,5g, 250mg.

Structural formula: {0} (CAS {1})

3-(4-sulfamoylpyrazol-1-yl)propanoic acid (CAS 1153823-55-2) is a chemical compound with the molecular formula C6H9N3O4S and a molecular weight of 219.22 g/mol. IUPAC name: 3-(4-sulfamoylpyrazol-1-yl)propanoic acid. InChIKey: GIEBWAUBLVZQGU-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9N3O4S
Molecular weight219.22 g/mol
IUPAC name3-(4-sulfamoylpyrazol-1-yl)propanoic acid
InChIKeyGIEBWAUBLVZQGU-UHFFFAOYSA-N
SMILESC1=C(C=NN1CCC(=O)O)S(=O)(=O)N

Computed by PubChem (NCBI)