CAS 923682-24-0 appears in our catalog under these names: 1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonamide, 95%, 1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide (CAS 923682-24-0) is a chemical compound with the molecular formula C6H9N3O4S and a molecular weight of 219.22 g/mol. IUPAC name: 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide. InChIKey: NKKXGPLLMYEAIU-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O4S |
|---|---|
| Molecular weight | 219.22 g/mol |
| IUPAC name | 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
| InChIKey | NKKXGPLLMYEAIU-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=O)N(C1=O)C)S(=O)(=O)N |
Computed by PubChem (NCBI)