Products 2137804-11-4
CAS 2137804-11-4 is the registry number for Methyl 1-methyl-3-sulfamoyl-1H-pyrazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 1-methyl-3-sulfamoylpyrazole-5-carboxylate (CAS 2137804-11-4) is a chemical compound with the molecular formula C6H9N3O4S and a molecular weight of 219.22 g/mol. IUPAC name: methyl 1-methyl-3-sulfamoylpyrazole-5-carboxylate. InChIKey: CGRADBMNTZZWHT-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O4S |
|---|---|
| Molecular weight | 219.22 g/mol |
| IUPAC name | methyl 1-methyl-3-sulfamoylpyrazole-5-carboxylate |
| InChIKey | CGRADBMNTZZWHT-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)S(=O)(=O)N)C(=O)OC |
Computed by PubChem (NCBI)