CAS 2238820-17-0 is the registry number for (S)-6-Hydroxy-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-3-sulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(6S)-6-hydroxy-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-3-sulfonamide (CAS 2238820-17-0) is a chemical compound with the molecular formula C6H9N3O4S and a molecular weight of 219.22 g/mol. IUPAC name: (6S)-6-hydroxy-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-3-sulfonamide. InChIKey: BDDYEMRZIKAJBO-BYPYZUCNSA-N.
| Molecular formula | C6H9N3O4S |
|---|---|
| Molecular weight | 219.22 g/mol |
| IUPAC name | (6S)-6-hydroxy-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-3-sulfonamide |
| InChIKey | BDDYEMRZIKAJBO-BYPYZUCNSA-N |
| SMILES | C1[C@@H](COC2=C(C=NN21)S(=O)(=O)N)O |
Computed by PubChem (NCBI)