CAS 115388-93-7 appears in our catalog under these names: L-Proline 7-Amido-4-methylcoumarin Hydrobromide, L-Proline-7-amido-4-methylcoumarin hydro, H-Pro-AMC.HBr, 97%, L-Proline 7-amido-4-methylcoumarin hydrobromide salt, L-Proline 7-amido-4-methylcoumarin hydro, bromide salt, 100 mg. Offered by: TRC, MedChemExpress, Sigma-Aldrich, Chemat Brand, Biosynth. Available pack sizes: 250mg, 50 mg, 25 mg, 50MG, on request, 0,25g, 0,1g, 0,5g.
(2S)-N-(4-methyl-2-oxochromen-7-yl)pyrrolidine-2-carboxamide;hydrobromide (CAS 115388-93-7) is a chemical compound with the molecular formula C15H17BrN2O3 and a molecular weight of 353.21 g/mol. IUPAC name: (2S)-N-(4-methyl-2-oxochromen-7-yl)pyrrolidine-2-carboxamide;hydrobromide. InChIKey: MMAGBLTXSIXDLZ-YDALLXLXSA-N.
| Molecular formula | C15H17BrN2O3 |
|---|---|
| Molecular weight | 353.21 g/mol |
| IUPAC name | (2S)-N-(4-methyl-2-oxochromen-7-yl)pyrrolidine-2-carboxamide;hydrobromide |
| InChIKey | MMAGBLTXSIXDLZ-YDALLXLXSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@@H]3CCCN3.Br |
Computed by PubChem (NCBI)