CAS 1609403-54-4 is the registry number for (4-Methoxybenzyl)(2-nitrobenzyl)amine hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-(4-methoxyphenyl)-N-[(2-nitrophenyl)methyl]methanamine;hydrobromide (CAS 1609403-54-4) is a chemical compound with the molecular formula C15H17BrN2O3 and a molecular weight of 353.21 g/mol. IUPAC name: 1-(4-methoxyphenyl)-N-[(2-nitrophenyl)methyl]methanamine;hydrobromide. InChIKey: ABCIQGUQGIJWIC-UHFFFAOYSA-N.
| Molecular formula | C15H17BrN2O3 |
|---|---|
| Molecular weight | 353.21 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)-N-[(2-nitrophenyl)methyl]methanamine;hydrobromide |
| InChIKey | ABCIQGUQGIJWIC-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CNCC2=CC=CC=C2[N+](=O)[O-].Br |
Computed by PubChem (NCBI)