CAS 138163-16-3 is the registry number for Benzyl 3-bromo-1-oxa-2,7-diazaspiro[4.5]dec-2-ene-7-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl 3-bromo-1-oxa-2,9-diazaspiro[4.5]dec-2-ene-9-carboxylate (CAS 138163-16-3) is a chemical compound with the molecular formula C15H17BrN2O3 and a molecular weight of 353.21 g/mol. IUPAC name: benzyl 3-bromo-1-oxa-2,9-diazaspiro[4.5]dec-2-ene-9-carboxylate. InChIKey: ZRKDHFCNIRRXJL-UHFFFAOYSA-N.
| Molecular formula | C15H17BrN2O3 |
|---|---|
| Molecular weight | 353.21 g/mol |
| IUPAC name | benzyl 3-bromo-1-oxa-2,9-diazaspiro[4.5]dec-2-ene-9-carboxylate |
| InChIKey | ZRKDHFCNIRRXJL-UHFFFAOYSA-N |
| SMILES | C1CC2(CC(=NO2)Br)CN(C1)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)