CAS 1310356-06-9 is the registry number for 5-Bromo-7-((4-piperidinylmethyl)amino)-2-benzofurancarboxylic Acid. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 50mg, 25mg, 100mg.
5-bromo-7-(piperidin-4-ylmethylamino)-1-benzofuran-2-carboxylic acid (CAS 1310356-06-9) is a chemical compound with the molecular formula C15H17BrN2O3 and a molecular weight of 353.21 g/mol. IUPAC name: 5-bromo-7-(piperidin-4-ylmethylamino)-1-benzofuran-2-carboxylic acid. InChIKey: JPSRNNAKSXAWPL-UHFFFAOYSA-N.
| Molecular formula | C15H17BrN2O3 |
|---|---|
| Molecular weight | 353.21 g/mol |
| IUPAC name | 5-bromo-7-(piperidin-4-ylmethylamino)-1-benzofuran-2-carboxylic acid |
| InChIKey | JPSRNNAKSXAWPL-UHFFFAOYSA-N |
| SMILES | C1CNCCC1CNC2=C3C(=CC(=C2)Br)C=C(O3)C(=O)O |
Computed by PubChem (NCBI)