CAS 1153904-75-6 appears in our catalog under these names: 3-((3-Chlorophenyl)methoxy)-4-methylaniline, 95%, 3-((3-Chlorophenyl)methoxy)-4-methylaniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-[(3-chlorophenyl)methoxy]-4-methylaniline (CAS 1153904-75-6) is a chemical compound with the molecular formula C14H14ClNO and a molecular weight of 247.72 g/mol. IUPAC name: 3-[(3-chlorophenyl)methoxy]-4-methylaniline. InChIKey: KLPVHHPWAWLDAU-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNO |
|---|---|
| Molecular weight | 247.72 g/mol |
| IUPAC name | 3-[(3-chlorophenyl)methoxy]-4-methylaniline |
| InChIKey | KLPVHHPWAWLDAU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N)OCC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)