CAS 1154-77-4 appears in our catalog under these names: 2',4'-Dimethoxychalcone, 2',4'-Dimethoxychalcone, 95%, 2',4'-Dimethoxychalcone, 98%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 2000mg, 1000mg, 5000mg, 250mg, 5g, 1g.
(E)-1-(2,4-dimethoxyphenyl)-3-phenylprop-2-en-1-one (CAS 1154-77-4) is a chemical compound with the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. IUPAC name: (E)-1-(2,4-dimethoxyphenyl)-3-phenylprop-2-en-1-one. InChIKey: ZRDCNUALRUCCPA-DHZHZOJOSA-N.
| Molecular formula | C17H16O3 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | (E)-1-(2,4-dimethoxyphenyl)-3-phenylprop-2-en-1-one |
| InChIKey | ZRDCNUALRUCCPA-DHZHZOJOSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)/C=C/C2=CC=CC=C2)OC |
Computed by PubChem (NCBI)