CAS 2270905-72-9 is the registry number for 4-Acetyl-2-methyl-benzoic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Benzyl 4-acetyl-2-methylbenzoate (CAS 2270905-72-9) is a chemical compound with the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. IUPAC name: benzyl 4-acetyl-2-methylbenzoate. InChIKey: TUCXEFIRALGOBO-UHFFFAOYSA-N.
| Molecular formula | C17H16O3 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | benzyl 4-acetyl-2-methylbenzoate |
| InChIKey | TUCXEFIRALGOBO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)C)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)