CAS 139149-27-2 is the registry number for 5-(4-Methoxy-benzyloxy)-indan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-[(4-methoxyphenyl)methoxy]-2,3-dihydroinden-1-one (CAS 139149-27-2) is a chemical compound with the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. IUPAC name: 5-[(4-methoxyphenyl)methoxy]-2,3-dihydroinden-1-one. InChIKey: RNSPONMRBZRWPU-UHFFFAOYSA-N.
| Molecular formula | C17H16O3 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | 5-[(4-methoxyphenyl)methoxy]-2,3-dihydroinden-1-one |
| InChIKey | RNSPONMRBZRWPU-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)COC2=CC3=C(C=C2)C(=O)CC3 |
Computed by PubChem (NCBI)