CAS 53744-28-8 appears in our catalog under these names: 3,4-Dimethoxychalcone, 95%, 3,4-Dimethoxychalcone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 5g, 10g, 50g.
(E)-3-(3,4-dimethoxyphenyl)-1-phenylprop-2-en-1-one (CAS 53744-28-8) is a chemical compound with the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. IUPAC name: (E)-3-(3,4-dimethoxyphenyl)-1-phenylprop-2-en-1-one. InChIKey: LSHZPTCZLWATBZ-CSKARUKUSA-N.
| Molecular formula | C17H16O3 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | (E)-3-(3,4-dimethoxyphenyl)-1-phenylprop-2-en-1-one |
| InChIKey | LSHZPTCZLWATBZ-CSKARUKUSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C/C(=O)C2=CC=CC=C2)OC |
Computed by PubChem (NCBI)