CAS 1154206-19-5 appears in our catalog under these names: 1-(2,6-Dichlorophenyl)-5-(propan-2-yl)-1h-1,2,4-triazole-3-carboxylic acid, 95%, 1-(2,6-Dichlorophenyl)-5-(propan-2-yl)-1H-1,2,4-triazole-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
1-(2,6-dichlorophenyl)-5-propan-2-yl-1,2,4-triazole-3-carboxylic acid (CAS 1154206-19-5) is a chemical compound with the molecular formula C12H11Cl2N3O2 and a molecular weight of 300.14 g/mol. IUPAC name: 1-(2,6-dichlorophenyl)-5-propan-2-yl-1,2,4-triazole-3-carboxylic acid. InChIKey: MJHINSZPNGBKAQ-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2N3O2 |
|---|---|
| Molecular weight | 300.14 g/mol |
| IUPAC name | 1-(2,6-dichlorophenyl)-5-propan-2-yl-1,2,4-triazole-3-carboxylic acid |
| InChIKey | MJHINSZPNGBKAQ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC(=NN1C2=C(C=CC=C2Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)