CAS 730949-87-8 appears in our catalog under these names: (5,7-Dichloro-2-methyl-quinolin-8-yloxy)-acetic acid hydrazide, 95%, 2-((5,7-Dichloro-2-methylquinolin-8-yl)oxy)acetohydrazide, 95%, 2-((5,7-Dichloro-2-methylquinolin-8-yl)oxy)acetohydrazide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetohydrazide (CAS 730949-87-8) is a chemical compound with the molecular formula C12H11Cl2N3O2 and a molecular weight of 300.14 g/mol. IUPAC name: 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetohydrazide. InChIKey: GFCBMQGESMIYDP-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2N3O2 |
|---|---|
| Molecular weight | 300.14 g/mol |
| IUPAC name | 2-(5,7-dichloro-2-methylquinolin-8-yl)oxyacetohydrazide |
| InChIKey | GFCBMQGESMIYDP-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C(=CC(=C2OCC(=O)NN)Cl)Cl |
Computed by PubChem (NCBI)