Products 636568-07-5
CAS 636568-07-5 is the registry number for Ethyl 5-amino-1-(3,4-dichlorophenyl)-1H-pyrazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5-amino-1-(3,4-dichlorophenyl)pyrazole-4-carboxylate (CAS 636568-07-5) is a chemical compound with the molecular formula C12H11Cl2N3O2 and a molecular weight of 300.14 g/mol. IUPAC name: ethyl 5-amino-1-(3,4-dichlorophenyl)pyrazole-4-carboxylate. InChIKey: NIESSKINRSMZLA-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2N3O2 |
|---|---|
| Molecular weight | 300.14 g/mol |
| IUPAC name | ethyl 5-amino-1-(3,4-dichlorophenyl)pyrazole-4-carboxylate |
| InChIKey | NIESSKINRSMZLA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)C2=CC(=C(C=C2)Cl)Cl)N |
Computed by PubChem (NCBI)