CAS 945138-51-2 is the registry number for 3-(3-(Chloromethyl)-1,2,4-oxadiazol-5-yl)-N-(4-chlorophenyl)propanamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[3-(chloromethyl)-1,2,4-oxadiazol-5-yl]-N-(4-chlorophenyl)propanamide (CAS 945138-51-2) is a chemical compound with the molecular formula C12H11Cl2N3O2 and a molecular weight of 300.14 g/mol. IUPAC name: 3-[3-(chloromethyl)-1,2,4-oxadiazol-5-yl]-N-(4-chlorophenyl)propanamide. InChIKey: KUJSVWYLYYNQRB-UHFFFAOYSA-N.
| Molecular formula | C12H11Cl2N3O2 |
|---|---|
| Molecular weight | 300.14 g/mol |
| IUPAC name | 3-[3-(chloromethyl)-1,2,4-oxadiazol-5-yl]-N-(4-chlorophenyl)propanamide |
| InChIKey | KUJSVWYLYYNQRB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)CCC2=NC(=NO2)CCl)Cl |
Computed by PubChem (NCBI)