Products 1154278-60-0
CAS 1154278-60-0 is the registry number for 5-Bromo-N-(1-methyl-1H-pyrazol-4-yl)thiophene-3-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-N-(1-methylpyrazol-4-yl)thiophene-3-carboxamide (CAS 1154278-60-0) is a chemical compound with the molecular formula C9H8BrN3OS and a molecular weight of 286.15 g/mol. IUPAC name: 5-bromo-N-(1-methylpyrazol-4-yl)thiophene-3-carboxamide. InChIKey: YQUSLEKVCUONSE-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3OS |
|---|---|
| Molecular weight | 286.15 g/mol |
| IUPAC name | 5-bromo-N-(1-methylpyrazol-4-yl)thiophene-3-carboxamide |
| InChIKey | YQUSLEKVCUONSE-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)NC(=O)C2=CSC(=C2)Br |
Computed by PubChem (NCBI)