Products 2709079-87-6
CAS 2709079-87-6 is the registry number for 3-(6-Bromo-1H-pyrazolo[3,4-b]pyridin-1-yl)thietane 1-oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(6-bromopyrazolo[5,4-b]pyridin-1-yl)thietane 1-oxide (CAS 2709079-87-6) is a chemical compound with the molecular formula C9H8BrN3OS and a molecular weight of 286.15 g/mol. IUPAC name: 3-(6-bromopyrazolo[5,4-b]pyridin-1-yl)thietane 1-oxide. InChIKey: CGKQCHVZRBLNSD-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3OS |
|---|---|
| Molecular weight | 286.15 g/mol |
| IUPAC name | 3-(6-bromopyrazolo[5,4-b]pyridin-1-yl)thietane 1-oxide |
| InChIKey | CGKQCHVZRBLNSD-UHFFFAOYSA-N |
| SMILES | C1C(CS1=O)N2C3=C(C=CC(=N3)Br)C=N2 |
Computed by PubChem (NCBI)