Products 1179024-63-5
CAS 1179024-63-5 appears in our catalog under these names: 5-(3-Bromo-4-methoxyphenyl)-4h-1,2,4-triazole-3-thiol, 95%, 5-(3-Bromo-4-methoxyphenyl)-4H-1,2,4-triazole-3-thiol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
5-(3-bromo-4-methoxyphenyl)-1,2-dihydro-1,2,4-triazole-3-thione (CAS 1179024-63-5) is a chemical compound with the molecular formula C9H8BrN3OS and a molecular weight of 286.15 g/mol. IUPAC name: 5-(3-bromo-4-methoxyphenyl)-1,2-dihydro-1,2,4-triazole-3-thione. InChIKey: HIUYRPZHXNAQKG-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3OS |
|---|---|
| Molecular weight | 286.15 g/mol |
| IUPAC name | 5-(3-bromo-4-methoxyphenyl)-1,2-dihydro-1,2,4-triazole-3-thione |
| InChIKey | HIUYRPZHXNAQKG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NC(=S)NN2)Br |
Computed by PubChem (NCBI)