Products 923701-18-2
CAS 923701-18-2 is the registry number for 4-Bromo-1-methyl-N-(thiazol-2-yl)-1H-pyrrole-2-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-1-methyl-N-(1,3-thiazol-2-yl)pyrrole-2-carboxamide (CAS 923701-18-2) is a chemical compound with the molecular formula C9H8BrN3OS and a molecular weight of 286.15 g/mol. IUPAC name: 4-bromo-1-methyl-N-(1,3-thiazol-2-yl)pyrrole-2-carboxamide. InChIKey: VUVXRDKPRVGSTE-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3OS |
|---|---|
| Molecular weight | 286.15 g/mol |
| IUPAC name | 4-bromo-1-methyl-N-(1,3-thiazol-2-yl)pyrrole-2-carboxamide |
| InChIKey | VUVXRDKPRVGSTE-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=C1C(=O)NC2=NC=CS2)Br |
Computed by PubChem (NCBI)