CAS 1154549-27-5 appears in our catalog under these names: 6-Ethyl-2-(4-methylphenyl)-3,4-dihydropyrimidin-4-one, 95%, 6-Ethyl-2-(4-methylphenyl)-3,4-dihydropyrimidin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-ethyl-2-(4-methylphenyl)-1H-pyrimidin-6-one (CAS 1154549-27-5) is a chemical compound with the molecular formula C13H14N2O and a molecular weight of 214.26 g/mol. IUPAC name: 4-ethyl-2-(4-methylphenyl)-1H-pyrimidin-6-one. InChIKey: UJVYVDKNXJYARD-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | 4-ethyl-2-(4-methylphenyl)-1H-pyrimidin-6-one |
| InChIKey | UJVYVDKNXJYARD-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=O)NC(=N1)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)