Products 1154650-50-6
CAS 1154650-50-6 appears in our catalog under these names: 1-(4-Aminophenyl)-1H-pyrazole-3-carboxamide, 97%, 1-(4-Aminophenyl)-1H-pyrazole-3-carboxamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-(4-aminophenyl)pyrazole-3-carboxamide (CAS 1154650-50-6) is a chemical compound with the molecular formula C10H10N4O and a molecular weight of 202.21 g/mol. IUPAC name: 1-(4-aminophenyl)pyrazole-3-carboxamide. InChIKey: HUVPQDVSCAXAFC-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 1-(4-aminophenyl)pyrazole-3-carboxamide |
| InChIKey | HUVPQDVSCAXAFC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)N2C=CC(=N2)C(=O)N |
Computed by PubChem (NCBI)