Products 115473-51-3
CAS 115473-51-3 appears in our catalog under these names: L-glutamic-3-13C acid, 99 atom % 13C, L-Glutamic acid-13C, 99.9%. Offered by: Sigma-Aldrich, MedChemExpress. Available pack sizes: 100MG, 1 mg, 10 mg, 5 mg.
(2S)-2-amino(313C)pentanedioic acid (CAS 115473-51-3) is a chemical compound with the molecular formula C5H9NO4 and a molecular weight of 148.12 g/mol. IUPAC name: (2S)-2-amino(313C)pentanedioic acid. InChIKey: WHUUTDBJXJRKMK-AANACRNLSA-N.
| Molecular formula | C5H9NO4 |
|---|---|
| Molecular weight | 148.12 g/mol |
| IUPAC name | (2S)-2-amino(313C)pentanedioic acid |
| InChIKey | WHUUTDBJXJRKMK-AANACRNLSA-N |
| SMILES | C([13CH2][C@@H](C(=O)O)N)C(=O)O |
Computed by PubChem (NCBI)