Products 115473-56-8
CAS 115473-56-8 is the registry number for L-Glutamic acid-13C2, 99.7%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 100 mg, 25 mg, 1 mg, 50 mg, 10 mg.
(2S)-2-amino(1,2-13C2)pentanedioic acid (CAS 115473-56-8) is a chemical compound with the molecular formula C5H9NO4 and a molecular weight of 149.11 g/mol. IUPAC name: (2S)-2-amino(1,2-13C2)pentanedioic acid. InChIKey: WHUUTDBJXJRKMK-JAWTVSONSA-N.
| Molecular formula | C5H9NO4 |
|---|---|
| Molecular weight | 149.11 g/mol |
| IUPAC name | (2S)-2-amino(1,2-13C2)pentanedioic acid |
| InChIKey | WHUUTDBJXJRKMK-JAWTVSONSA-N |
| SMILES | C(CC(=O)O)[13C@@H]([13C](=O)O)N |
Computed by PubChem (NCBI)