CAS 1154733-46-6 is the registry number for 2-((1,3,4-Thiadiazol-2-yl)thio)-1-(2,4-dimethylphenyl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,4-dimethylphenyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)ethanone (CAS 1154733-46-6) is a chemical compound with the molecular formula C12H12N2OS2 and a molecular weight of 264.4 g/mol. IUPAC name: 1-(2,4-dimethylphenyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)ethanone. InChIKey: YHRKIZIQYDGACC-UHFFFAOYSA-N.
| Molecular formula | C12H12N2OS2 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | 1-(2,4-dimethylphenyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)ethanone |
| InChIKey | YHRKIZIQYDGACC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)CSC2=NN=CS2)C |
Computed by PubChem (NCBI)