CAS 334500-76-4 is the registry number for 2-((4,6-Dimethylpyrimidin-2-yl)thio)-1-(thiophen-2-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-thiophen-2-ylethanone (CAS 334500-76-4) is a chemical compound with the molecular formula C12H12N2OS2 and a molecular weight of 264.4 g/mol. IUPAC name: 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-thiophen-2-ylethanone. InChIKey: ZXZDQOVTGVYITO-UHFFFAOYSA-N.
| Molecular formula | C12H12N2OS2 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-1-thiophen-2-ylethanone |
| InChIKey | ZXZDQOVTGVYITO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)SCC(=O)C2=CC=CS2)C |
Computed by PubChem (NCBI)