Products 380471-64-7
CAS 380471-64-7 is the registry number for N-(4-methylthiazol-2-yl)-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 5mg, 25mg, 50mg, 100mg, 250mg.
N-(4-methyl-1,3-thiazol-2-yl)-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide (CAS 380471-64-7) is a chemical compound with the molecular formula C12H12N2OS2 and a molecular weight of 264.4 g/mol. IUPAC name: N-(4-methyl-1,3-thiazol-2-yl)-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide. InChIKey: WPEMSLLHFQQWKZ-UHFFFAOYSA-N.
| Molecular formula | C12H12N2OS2 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | N-(4-methyl-1,3-thiazol-2-yl)-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide |
| InChIKey | WPEMSLLHFQQWKZ-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)NC(=O)C2=CC3=C(S2)CCC3 |
Computed by PubChem (NCBI)