CAS 931068-30-3 is the registry number for N-Allyl-4-methyl-2-(thiophen-2-yl)thiazole-5-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methyl-N-prop-2-enyl-2-thiophen-2-yl-1,3-thiazole-5-carboxamide (CAS 931068-30-3) is a chemical compound with the molecular formula C12H12N2OS2 and a molecular weight of 264.4 g/mol. IUPAC name: 4-methyl-N-prop-2-enyl-2-thiophen-2-yl-1,3-thiazole-5-carboxamide. InChIKey: PWFFZBUKFIOVIQ-UHFFFAOYSA-N.
| Molecular formula | C12H12N2OS2 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | 4-methyl-N-prop-2-enyl-2-thiophen-2-yl-1,3-thiazole-5-carboxamide |
| InChIKey | PWFFZBUKFIOVIQ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC=CS2)C(=O)NCC=C |
Computed by PubChem (NCBI)