CAS 1154762-97-6 appears in our catalog under these names: 2-(1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl)acetic acid, 97%, 97%, 2-(1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl)acetic acid, 97%, 2-(1-Methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl)acetic acid, [1-methyl-3-(trifluoromethyl)-1H-pyrazol-5-yl]acetic acid, 97%. Offered by: Chemat, AmBeed, Biosynth, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 0,5g, 50mg.
2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]acetic acid (CAS 1154762-97-6) is a chemical compound with the molecular formula C7H7F3N2O2 and a molecular weight of 208.14 g/mol. IUPAC name: 2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]acetic acid. InChIKey: BGGSLYWGXKBFSE-UHFFFAOYSA-N.
| Molecular formula | C7H7F3N2O2 |
|---|---|
| Molecular weight | 208.14 g/mol |
| IUPAC name | 2-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]acetic acid |
| InChIKey | BGGSLYWGXKBFSE-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C(F)(F)F)CC(=O)O |
Computed by PubChem (NCBI)