Products 1154945-91-1
CAS 1154945-91-1 is the registry number for 2,4,5-Trimethyl-N-(1H-pyrazol-4-yl)furan-3-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4,5-trimethyl-N-(1H-pyrazol-4-yl)furan-3-carboxamide (CAS 1154945-91-1) is a chemical compound with the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. IUPAC name: 2,4,5-trimethyl-N-(1H-pyrazol-4-yl)furan-3-carboxamide. InChIKey: ZZVTVHRHEIDUES-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O2 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 2,4,5-trimethyl-N-(1H-pyrazol-4-yl)furan-3-carboxamide |
| InChIKey | ZZVTVHRHEIDUES-UHFFFAOYSA-N |
| SMILES | CC1=C(OC(=C1C(=O)NC2=CNN=C2)C)C |
Computed by PubChem (NCBI)