CAS 1154953-36-2 is the registry number for 2-(2,4-Dichlorophenyl)-N-(1H-pyrazol-4-yl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,4-dichlorophenyl)-N-(1H-pyrazol-4-yl)acetamide (CAS 1154953-36-2) is a chemical compound with the molecular formula C11H9Cl2N3O and a molecular weight of 270.11 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-N-(1H-pyrazol-4-yl)acetamide. InChIKey: DISVPEFSFZICKA-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2N3O |
|---|---|
| Molecular weight | 270.11 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)-N-(1H-pyrazol-4-yl)acetamide |
| InChIKey | DISVPEFSFZICKA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CC(=O)NC2=CNN=C2 |
Computed by PubChem (NCBI)