CAS 519056-56-5 is the registry number for 1-(1-(2,3-Dichlorophenyl)-5-methyl-1H-1,2,3-triazol-4-yl)ethanone, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[1-(2,3-dichlorophenyl)-5-methyltriazol-4-yl]ethanone (CAS 519056-56-5) is a chemical compound with the molecular formula C11H9Cl2N3O and a molecular weight of 270.11 g/mol. IUPAC name: 1-[1-(2,3-dichlorophenyl)-5-methyltriazol-4-yl]ethanone. InChIKey: ZQIKSAPYGKRXTA-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2N3O |
|---|---|
| Molecular weight | 270.11 g/mol |
| IUPAC name | 1-[1-(2,3-dichlorophenyl)-5-methyltriazol-4-yl]ethanone |
| InChIKey | ZQIKSAPYGKRXTA-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1C2=C(C(=CC=C2)Cl)Cl)C(=O)C |
Computed by PubChem (NCBI)