CAS 335649-13-3 appears in our catalog under these names: 4,6-Dichloro-N-(4-methoxyphenyl)pyrimidin-2-amine, 95%, 4,6-Dichloro-N-(4-methoxyphenyl)pyrimidin-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4,6-dichloro-N-(4-methoxyphenyl)pyrimidin-2-amine (CAS 335649-13-3) is a chemical compound with the molecular formula C11H9Cl2N3O and a molecular weight of 270.11 g/mol. IUPAC name: 4,6-dichloro-N-(4-methoxyphenyl)pyrimidin-2-amine. InChIKey: PECXBVRBVFBWOE-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2N3O |
|---|---|
| Molecular weight | 270.11 g/mol |
| IUPAC name | 4,6-dichloro-N-(4-methoxyphenyl)pyrimidin-2-amine |
| InChIKey | PECXBVRBVFBWOE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NC2=NC(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)