CAS 64211-06-9 appears in our catalog under these names: Oxiconazole Related Compound B, (Z)-1-(2,4-Dichlorophenyl)-2-(1H-imidazol-1-yl)ethanone Hydroxime. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
(NZ)-N-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethylidene]hydroxylamine (CAS 64211-06-9) is a chemical compound with the molecular formula C11H9Cl2N3O and a molecular weight of 270.11 g/mol. IUPAC name: (NZ)-N-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethylidene]hydroxylamine. InChIKey: WDFDJSRQMAZXEJ-RVDMUPIBSA-N.
| Molecular formula | C11H9Cl2N3O |
|---|---|
| Molecular weight | 270.11 g/mol |
| IUPAC name | (NZ)-N-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethylidene]hydroxylamine |
| InChIKey | WDFDJSRQMAZXEJ-RVDMUPIBSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)/C(=N/O)/CN2C=CN=C2 |
Computed by PubChem (NCBI)