Products 1155371-83-7
CAS 1155371-83-7 is the registry number for (5-Isopropyl-2,4-dimethoxyphenyl)boronic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,4-dimethoxy-5-propan-2-ylphenyl)boronic acid (CAS 1155371-83-7) is a chemical compound with the molecular formula C11H17BO4 and a molecular weight of 224.06 g/mol. IUPAC name: (2,4-dimethoxy-5-propan-2-ylphenyl)boronic acid. InChIKey: WLUQWJWTALOWNZ-UHFFFAOYSA-N.
| Molecular formula | C11H17BO4 |
|---|---|
| Molecular weight | 224.06 g/mol |
| IUPAC name | (2,4-dimethoxy-5-propan-2-ylphenyl)boronic acid |
| InChIKey | WLUQWJWTALOWNZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1OC)OC)C(C)C)(O)O |
Computed by PubChem (NCBI)