Products 1629972-11-7

CAS 1629972-11-7 is the registry number for 3-Isobutoxy-4-methoxyphenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

[4-methoxy-3-(2-methylpropoxy)phenyl]boronic acid (CAS 1629972-11-7) is a chemical compound with the molecular formula C11H17BO4 and a molecular weight of 224.06 g/mol. IUPAC name: [4-methoxy-3-(2-methylpropoxy)phenyl]boronic acid. InChIKey: CKPKCAUMWQUFLE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17BO4
Molecular weight224.06 g/mol
IUPAC name[4-methoxy-3-(2-methylpropoxy)phenyl]boronic acid
InChIKeyCKPKCAUMWQUFLE-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1)OC)OCC(C)C)(O)O

Computed by PubChem (NCBI)