Products 2376142-64-0
CAS 2376142-64-0 is the registry number for (5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-yl)methanol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-yl]methanol (CAS 2376142-64-0) is a chemical compound with the molecular formula C11H17BO4 and a molecular weight of 224.06 g/mol. IUPAC name: [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-yl]methanol. InChIKey: RXHHWCRQOGFQKW-UHFFFAOYSA-N.
| Molecular formula | C11H17BO4 |
|---|---|
| Molecular weight | 224.06 g/mol |
| IUPAC name | [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-2-yl]methanol |
| InChIKey | RXHHWCRQOGFQKW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(O2)CO |
Computed by PubChem (NCBI)