Products 565452-39-3

CAS 565452-39-3 is the registry number for 4-(Methoxymethoxy)-3-(1-methylethyl)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

[4-(methoxymethoxy)-3-propan-2-ylphenyl]boronic acid (CAS 565452-39-3) is a chemical compound with the molecular formula C11H17BO4 and a molecular weight of 224.06 g/mol. IUPAC name: [4-(methoxymethoxy)-3-propan-2-ylphenyl]boronic acid. InChIKey: XHKJRMKWNJCEJS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17BO4
Molecular weight224.06 g/mol
IUPAC name[4-(methoxymethoxy)-3-propan-2-ylphenyl]boronic acid
InChIKeyXHKJRMKWNJCEJS-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1)OCOC)C(C)C)(O)O

Computed by PubChem (NCBI)