Products 565452-39-3
CAS 565452-39-3 is the registry number for 4-(Methoxymethoxy)-3-(1-methylethyl)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
[4-(methoxymethoxy)-3-propan-2-ylphenyl]boronic acid (CAS 565452-39-3) is a chemical compound with the molecular formula C11H17BO4 and a molecular weight of 224.06 g/mol. IUPAC name: [4-(methoxymethoxy)-3-propan-2-ylphenyl]boronic acid. InChIKey: XHKJRMKWNJCEJS-UHFFFAOYSA-N.
| Molecular formula | C11H17BO4 |
|---|---|
| Molecular weight | 224.06 g/mol |
| IUPAC name | [4-(methoxymethoxy)-3-propan-2-ylphenyl]boronic acid |
| InChIKey | XHKJRMKWNJCEJS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCOC)C(C)C)(O)O |
Computed by PubChem (NCBI)