Products 1155538-89-8
CAS 1155538-89-8 appears in our catalog under these names: 6-(1,1-Dioxidothiomorpholine-4-carbonyl)picolinic acid, 95%, 6-(1,1-Dioxo-1,4-thiazinane-4-carbonyl)pyridine-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-(1,1-dioxo-1,4-thiazinane-4-carbonyl)pyridine-2-carboxylic acid (CAS 1155538-89-8) is a chemical compound with the molecular formula C11H12N2O5S and a molecular weight of 284.29 g/mol. IUPAC name: 6-(1,1-dioxo-1,4-thiazinane-4-carbonyl)pyridine-2-carboxylic acid. InChIKey: FEALAHKKLPRQDT-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O5S |
|---|---|
| Molecular weight | 284.29 g/mol |
| IUPAC name | 6-(1,1-dioxo-1,4-thiazinane-4-carbonyl)pyridine-2-carboxylic acid |
| InChIKey | FEALAHKKLPRQDT-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1C(=O)C2=NC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)