Products 81416-56-0

CAS 81416-56-0 is the registry number for 4-Hydroxyantipyrine Sulfate. Offered by: TRC. Available pack sizes: 25mg, 500mg.

Structural formula: {0} (CAS {1})

(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl) hydrogen sulfate (CAS 81416-56-0) is a chemical compound with the molecular formula C11H12N2O5S and a molecular weight of 284.29 g/mol. IUPAC name: (1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl) hydrogen sulfate. InChIKey: CTEXUEWYEUYLCH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12N2O5S
Molecular weight284.29 g/mol
IUPAC name(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl) hydrogen sulfate
InChIKeyCTEXUEWYEUYLCH-UHFFFAOYSA-N
SMILESCC1=C(C(=O)N(N1C)C2=CC=CC=C2)OS(=O)(=O)O

Computed by PubChem (NCBI)