CAS 81416-56-0 is the registry number for 4-Hydroxyantipyrine Sulfate. Offered by: TRC. Available pack sizes: 25mg, 500mg.
(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl) hydrogen sulfate (CAS 81416-56-0) is a chemical compound with the molecular formula C11H12N2O5S and a molecular weight of 284.29 g/mol. IUPAC name: (1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl) hydrogen sulfate. InChIKey: CTEXUEWYEUYLCH-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O5S |
|---|---|
| Molecular weight | 284.29 g/mol |
| IUPAC name | (1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl) hydrogen sulfate |
| InChIKey | CTEXUEWYEUYLCH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(N1C)C2=CC=CC=C2)OS(=O)(=O)O |
Computed by PubChem (NCBI)