Products 2306500-72-9
CAS 2306500-72-9 is the registry number for Tryptophan Impurity 8. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-3-(2-sulfo-1H-indol-3-yl)propanoic acid (CAS 2306500-72-9) is a chemical compound with the molecular formula C11H12N2O5S and a molecular weight of 284.29 g/mol. IUPAC name: (2S)-2-amino-3-(2-sulfo-1H-indol-3-yl)propanoic acid. InChIKey: JUCXIYGDXYUXSG-QMMMGPOBSA-N.
| Molecular formula | C11H12N2O5S |
|---|---|
| Molecular weight | 284.29 g/mol |
| IUPAC name | (2S)-2-amino-3-(2-sulfo-1H-indol-3-yl)propanoic acid |
| InChIKey | JUCXIYGDXYUXSG-QMMMGPOBSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)S(=O)(=O)O)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)