Products 63674-74-8
CAS 63674-74-8 appears in our catalog under these names: 1-[4-(Aminosulfonyl)phenyl]-5-oxopyrrolidine-3-carboxylic acid, 95%, 1-(4-(AMinosulfonyl)phenyl)-5-oxopyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
5-oxo-1-(4-sulfamoylphenyl)pyrrolidine-3-carboxylic acid (CAS 63674-74-8) is a chemical compound with the molecular formula C11H12N2O5S and a molecular weight of 284.29 g/mol. IUPAC name: 5-oxo-1-(4-sulfamoylphenyl)pyrrolidine-3-carboxylic acid. InChIKey: PQTYDOPYQOAELL-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O5S |
|---|---|
| Molecular weight | 284.29 g/mol |
| IUPAC name | 5-oxo-1-(4-sulfamoylphenyl)pyrrolidine-3-carboxylic acid |
| InChIKey | PQTYDOPYQOAELL-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)C2=CC=C(C=C2)S(=O)(=O)N)C(=O)O |
Computed by PubChem (NCBI)